C18H19BrN2O8 — CID 17367872
N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-2-methyl-4-nitroaniline;oxalic acid (PubChem CID 17367872) has the molecular formula C18H19BrN2O8 and a molecular weight of 471.26 g/mol. Its IUPAC name is N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-2-methyl-4-nitroaniline;oxalic acid.
| Compound Name | N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-2-methyl-4-nitroaniline;oxalic acid |
|---|---|
| PubChem CID | 17367872 |
| Molecular Formula | C18H19BrN2O8 |
| Molecular Weight | 471.26 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | N-[(5-bromo-2,4-dimethoxyphenyl)methyl]-2-methyl-4-nitroaniline;oxalic acid |
| SMILES | COc1cc(OC)c(CNc2ccc([N+](=O)[O-])cc2C)cc1Br.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H17BrN2O4.C2H2O4/c1-10-6-12(19(20)21)4-5-14(10)18-9-11-7-13(17)16(23-3)8-15(11)22-2;3-1(4)2(5)6/h4-8,18H,9H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | GPZXUQDDZJKGRJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|