C18H23N3O3S — CID 100667911
1-[(3,4-diethoxyphenyl)methyl]-3-(3-methoxy-2-pyridinyl)thiourea (PubChem CID 100667911) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 1-[(3,4-diethoxyphenyl)methyl]-3-(3-methoxy-2-pyridinyl)thiourea.
| Compound Name | 1-[(3,4-diethoxyphenyl)methyl]-3-(3-methoxy-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100667911 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1-[(3,4-diethoxyphenyl)methyl]-3-(3-methoxy-2-pyridinyl)thiourea |
| SMILES | CCOc1ccc(CNC(=S)Nc2ncccc2OC)cc1OCC |
| InChI | InChI=1S/C18H23N3O3S/c1-4-23-14-9-8-13(11-16(14)24-5-2)12-20-18(25)21-17-15(22-3)7-6-10-19-17/h6-11H,4-5,12H2,1-3H3,(H2,19,20,21,25) |
| InChIKey | NOZSOAPBHDJYKC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|