C9H8N2O2 — CID 131155873
N-(3-methoxy-2-pyridinyl)prop-2-ynamide (PubChem CID 131155873) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is N-(3-methoxy-2-pyridinyl)prop-2-ynamide.
| Compound Name | N-(3-methoxy-2-pyridinyl)prop-2-ynamide |
|---|---|
| PubChem CID | 131155873 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | N-(3-methoxy-2-pyridinyl)prop-2-ynamide |
| SMILES | C#CC(=O)Nc1ncccc1OC |
| InChI | InChI=1S/C9H8N2O2/c1-3-8(12)11-9-7(13-2)5-4-6-10-9/h1,4-6H,2H3,(H,10,11,12) |
| InChIKey | ZHYAOTXICHEMQN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|