C15H17N3O3 — CID 20714362
methyl 2-[3-(aminomethyl)anilino]-6-methoxypyridine-3-carboxylate (PubChem CID 20714362) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is methyl 2-[3-(aminomethyl)anilino]-6-methoxypyridine-3-carboxylate.
| Compound Name | methyl 2-[3-(aminomethyl)anilino]-6-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 20714362 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | methyl 2-[3-(aminomethyl)anilino]-6-methoxypyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(OC)nc1Nc1cccc(CN)c1 |
| InChI | InChI=1S/C15H17N3O3/c1-20-13-7-6-12(15(19)21-2)14(18-13)17-11-5-3-4-10(8-11)9-16/h3-8H,9,16H2,1-2H3,(H,17,18) |
| InChIKey | UGPWZVNZLIFJQO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |