C15H21N3O — CID 157374019
N-[3-(aminomethyl)phenyl]-6-methoxy-4-methylpyridin-2-amine;methane (PubChem CID 157374019) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[3-(aminomethyl)phenyl]-6-methoxy-4-methylpyridin-2-amine;methane.
| Compound Name | N-[3-(aminomethyl)phenyl]-6-methoxy-4-methylpyridin-2-amine;methane |
|---|---|
| PubChem CID | 157374019 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-[3-(aminomethyl)phenyl]-6-methoxy-4-methylpyridin-2-amine;methane |
| SMILES | C.COc1cc(C)cc(Nc2cccc(CN)c2)n1 |
| InChI | InChI=1S/C14H17N3O.CH4/c1-10-6-13(17-14(7-10)18-2)16-12-5-3-4-11(8-12)9-15;/h3-8H,9,15H2,1-2H3,(H,16,17);1H4 |
| InChIKey | BKCKUJDJWZPRRQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |