C16H15Cl2NO4 — CID 11602849
2-[3,5-dichloro-4-(2-methoxyethoxy)anilino]benzoic acid (PubChem CID 11602849) has the molecular formula C16H15Cl2NO4 and a molecular weight of 356.21 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(2-methoxyethoxy)anilino]benzoic acid.
| Compound Name | 2-[3,5-dichloro-4-(2-methoxyethoxy)anilino]benzoic acid |
|---|---|
| PubChem CID | 11602849 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-[3,5-dichloro-4-(2-methoxyethoxy)anilino]benzoic acid |
| SMILES | COCCOc1c(Cl)cc(Nc2ccccc2C(=O)O)cc1Cl |
| InChI | InChI=1S/C16H15Cl2NO4/c1-22-6-7-23-15-12(17)8-10(9-13(15)18)19-14-5-3-2-4-11(14)16(20)21/h2-5,8-9,19H,6-7H2,1H3,(H,20,21) |
| InChIKey | HKALYJNODHYLDC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|