C12H7Cl2N3O4 — CID 158494808
2-(3,5-dichloro-2-nitroanilino)pyridine-3-carboxylic acid (PubChem CID 158494808) has the molecular formula C12H7Cl2N3O4 and a molecular weight of 328.11 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-nitroanilino)pyridine-3-carboxylic acid.
| Compound Name | 2-(3,5-dichloro-2-nitroanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 158494808 |
| Molecular Formula | C12H7Cl2N3O4 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 2-(3,5-dichloro-2-nitroanilino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1Nc1cc(Cl)cc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7Cl2N3O4/c13-6-4-8(14)10(17(20)21)9(5-6)16-11-7(12(18)19)2-1-3-15-11/h1-5H,(H,15,16)(H,18,19) |
| InChIKey | HJDLCXMFKFIWGN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|