About 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide
2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide (PubChem CID 133332314) has the molecular formula C11H19N3O3S
and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide |
| PubChem CID | 133332314 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide |
| SMILES | CC(C)(CCO)CNc1ncccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H19N3O3S/c1-11(2,5-7-15)8-14-10-9(18(12,16)17)4-3-6-13-10/h3-4,6,15H,5,7-8H2,1-2H3,(H,13,14)(H2,12,16,17) |
| InChIKey | LLHZWZVYBSWIFA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide?
The IUPAC name of 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide (CID 133332314) is 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide.
What is the SMILES notation for 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide?
The canonical SMILES for 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide is CC(C)(CCO)CNc1ncccc1S(N)(=O)=O.
What is the InChIKey of 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide?
The InChIKey is LLHZWZVYBSWIFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3S/c1-11(2,5-7-15)8-14-10-9(18(12,16)17)4-3-6-13-10/h3-4,6,15H,5,7-8H2,1-2H3,(H,13,14)(H2,12,16,17).
What are the key properties of 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide?
2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide has a molecular weight of 273.36 g/mol, XLogP of 0.55, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-hydroxy-2,2-dimethylbutyl)amino]pyridine-3-sulfonamide is sourced from PubChem (CID 133332314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).