C12H20N4O3S — CID 133326821
2,2-dimethyl-N-[2-[(3-sulfamoyl-2-pyridinyl)amino]ethyl]propanamide (PubChem CID 133326821) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[(3-sulfamoyl-2-pyridinyl)amino]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[(3-sulfamoyl-2-pyridinyl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 133326821 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2,2-dimethyl-N-[2-[(3-sulfamoyl-2-pyridinyl)amino]ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCNc1ncccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H20N4O3S/c1-12(2,3)11(17)16-8-7-15-10-9(20(13,18)19)5-4-6-14-10/h4-6H,7-8H2,1-3H3,(H,14,15)(H,16,17)(H2,13,18,19) |
| InChIKey | FOMCJBQTBLJODW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|