C18H23N3O2S — CID 3058616
3-(dimethylamino)propyl 2-(3-methylsulfanylanilino)pyridine-3-carboxylate (PubChem CID 3058616) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2-(3-methylsulfanylanilino)pyridine-3-carboxylate.
| Compound Name | 3-(dimethylamino)propyl 2-(3-methylsulfanylanilino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 3058616 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-(dimethylamino)propyl 2-(3-methylsulfanylanilino)pyridine-3-carboxylate |
| SMILES | CSc1cccc(Nc2ncccc2C(=O)OCCCN(C)C)c1 |
| InChI | InChI=1S/C18H23N3O2S/c1-21(2)11-6-12-23-18(22)16-9-5-10-19-17(16)20-14-7-4-8-15(13-14)24-3/h4-5,7-10,13H,6,11-12H2,1-3H3,(H,19,20) |
| InChIKey | UVATYIOGUPRNCT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|