C16H19N3OS — CID 63360686
4-amino-N-ethyl-3-(3-methylsulfanylanilino)benzamide (PubChem CID 63360686) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 4-amino-N-ethyl-3-(3-methylsulfanylanilino)benzamide.
| Compound Name | 4-amino-N-ethyl-3-(3-methylsulfanylanilino)benzamide |
|---|---|
| PubChem CID | 63360686 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-amino-N-ethyl-3-(3-methylsulfanylanilino)benzamide |
| SMILES | CCNC(=O)c1ccc(N)c(Nc2cccc(SC)c2)c1 |
| InChI | InChI=1S/C16H19N3OS/c1-3-18-16(20)11-7-8-14(17)15(9-11)19-12-5-4-6-13(10-12)21-2/h4-10,19H,3,17H2,1-2H3,(H,18,20) |
| InChIKey | NGIZHNGLRYYXMN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|