C15H15ClFN3O — CID 107526839
4-amino-3-(2-chloro-5-fluoroanilino)-N-ethylbenzamide (PubChem CID 107526839) has the molecular formula C15H15ClFN3O and a molecular weight of 307.76 g/mol. Its IUPAC name is 4-amino-3-(2-chloro-5-fluoroanilino)-N-ethylbenzamide.
| Compound Name | 4-amino-3-(2-chloro-5-fluoroanilino)-N-ethylbenzamide |
|---|---|
| PubChem CID | 107526839 |
| Molecular Formula | C15H15ClFN3O |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-amino-3-(2-chloro-5-fluoroanilino)-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(N)c(Nc2cc(F)ccc2Cl)c1 |
| InChI | InChI=1S/C15H15ClFN3O/c1-2-19-15(21)9-3-6-12(18)14(7-9)20-13-8-10(17)4-5-11(13)16/h3-8,20H,2,18H2,1H3,(H,19,21) |
| InChIKey | NHWVHVZUOZUYTD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|