C12H13N3 — CID 79003921
6-methyl-2-N-phenylpyridine-2,3-diamine (PubChem CID 79003921) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 6-methyl-2-N-phenylpyridine-2,3-diamine.
| Compound Name | 6-methyl-2-N-phenylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 79003921 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 6-methyl-2-N-phenylpyridine-2,3-diamine |
| SMILES | Cc1ccc(N)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H13N3/c1-9-7-8-11(13)12(14-9)15-10-5-3-2-4-6-10/h2-8H,13H2,1H3,(H,14,15) |
| InChIKey | MTHFOXUPFQTKJZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |