About CID 88886077
CID 88886077 (PubChem CID 88886077) has the molecular formula C11H10BN3
and a molecular weight of 195.03 g/mol.
Molecular Properties
| Compound Name | CID 88886077 |
| PubChem CID | 88886077 |
| Molecular Formula | C11H10BN3 |
| Molecular Weight | 195.03 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C11H10BN3/c12-10-7-6-9(13)11(15-10)14-8-4-2-1-3-5-8/h1-7H,13H2,(H,14,15) |
| InChIKey | JGVCQZQSSPEIFM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.03 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88886077 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88886077?
The IUPAC name of CID 88886077 (CID 88886077) is not available.
What is the SMILES notation for CID 88886077?
The canonical SMILES for CID 88886077 is [B]c1ccc(N)c(Nc2ccccc2)n1.
What is the InChIKey of CID 88886077?
The InChIKey is JGVCQZQSSPEIFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BN3/c12-10-7-6-9(13)11(15-10)14-8-4-2-1-3-5-8/h1-7H,13H2,(H,14,15).
What are the key properties of CID 88886077?
CID 88886077 has a molecular weight of 195.03 g/mol, XLogP of 1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88886077 is sourced from PubChem (CID 88886077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).