C10H12N4 — CID 82235464
2-methyl-4-N-phenyl-1H-imidazole-4,5-diamine (PubChem CID 82235464) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-methyl-4-N-phenyl-1H-imidazole-4,5-diamine.
| Compound Name | 2-methyl-4-N-phenyl-1H-imidazole-4,5-diamine |
|---|---|
| PubChem CID | 82235464 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2-methyl-4-N-phenyl-1H-imidazole-4,5-diamine |
| SMILES | Cc1nc(Nc2ccccc2)c(N)[nH]1 |
| InChI | InChI=1S/C10H12N4/c1-7-12-9(11)10(13-7)14-8-5-3-2-4-6-8/h2-6,14H,11H2,1H3,(H,12,13) |
| InChIKey | NESGXBGDXRMIJT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |