C14H20N4O — CID 55060202
4-N-(3-butan-2-yloxyphenyl)-2-methyl-1H-imidazole-4,5-diamine (PubChem CID 55060202) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-N-(3-butan-2-yloxyphenyl)-2-methyl-1H-imidazole-4,5-diamine.
| Compound Name | 4-N-(3-butan-2-yloxyphenyl)-2-methyl-1H-imidazole-4,5-diamine |
|---|---|
| PubChem CID | 55060202 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 4-N-(3-butan-2-yloxyphenyl)-2-methyl-1H-imidazole-4,5-diamine |
| SMILES | CCC(C)Oc1cccc(Nc2nc(C)[nH]c2N)c1 |
| InChI | InChI=1S/C14H20N4O/c1-4-9(2)19-12-7-5-6-11(8-12)18-14-13(15)16-10(3)17-14/h5-9,18H,4,15H2,1-3H3,(H,16,17) |
| InChIKey | NJDMZJBBJKGNPQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |