C10H9F3N4 — CID 114996935
2-methyl-4-N-(3,4,5-trifluorophenyl)-1H-imidazole-4,5-diamine (PubChem CID 114996935) has the molecular formula C10H9F3N4 and a molecular weight of 242.20 g/mol. Its IUPAC name is 2-methyl-4-N-(3,4,5-trifluorophenyl)-1H-imidazole-4,5-diamine.
| Compound Name | 2-methyl-4-N-(3,4,5-trifluorophenyl)-1H-imidazole-4,5-diamine |
|---|---|
| PubChem CID | 114996935 |
| Molecular Formula | C10H9F3N4 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-methyl-4-N-(3,4,5-trifluorophenyl)-1H-imidazole-4,5-diamine |
| SMILES | Cc1nc(Nc2cc(F)c(F)c(F)c2)c(N)[nH]1 |
| InChI | InChI=1S/C10H9F3N4/c1-4-15-9(14)10(16-4)17-5-2-6(11)8(13)7(12)3-5/h2-3,17H,14H2,1H3,(H,15,16) |
| InChIKey | QQMKBYNHUUKVFN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|