C10H6F4N4 — CID 80824688
5-fluoro-4-N-(3,4,5-trifluorophenyl)pyrimidine-2,4-diamine (PubChem CID 80824688) has the molecular formula C10H6F4N4 and a molecular weight of 258.18 g/mol. Its IUPAC name is 5-fluoro-4-N-(3,4,5-trifluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-4-N-(3,4,5-trifluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80824688 |
| Molecular Formula | C10H6F4N4 |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 5-fluoro-4-N-(3,4,5-trifluorophenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(F)c(Nc2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C10H6F4N4/c11-5-1-4(2-6(12)8(5)14)17-9-7(13)3-16-10(15)18-9/h1-3H,(H3,15,16,17,18) |
| InChIKey | IALAMHFFSXYAFB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|