C12H13N3 — CID 518389
3,6-dimethyl-N-phenylpyrazin-2-amine (PubChem CID 518389) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 3,6-dimethyl-N-phenylpyrazin-2-amine.
| Compound Name | 3,6-dimethyl-N-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 518389 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 3,6-dimethyl-N-phenylpyrazin-2-amine |
| SMILES | Cc1cnc(C)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H13N3/c1-9-8-13-10(2)12(14-9)15-11-6-4-3-5-7-11/h3-8H,1-2H3,(H,14,15) |
| InChIKey | POVOGNYQAMJQOM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |