4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid

C13H12FN3O2 — CID 114002149

IUPAC4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid
SMILESCc1cc(C)nc(Nc2ccc(C(=O)O)c(F)c2)n1
InChIInChI=1S/C13H12FN3O2/c1-7-5-8(2)16-13(15-7)17-9-3-4-10(12(18)19)11(14)6-9/h3-6H,1-2H3,(H,18,19)(H,15,16,17)
InChIKeyQUKHNCMRCZHHAT-UHFFFAOYSA-N
MW261.26 g/mol
LogP2.67
Rot. Bonds3

About 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid

4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid (PubChem CID 114002149) has the molecular formula C13H12FN3O2 and a molecular weight of 261.26 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid.

Molecular Properties

Compound Name4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid
PubChem CID114002149
Molecular FormulaC13H12FN3O2
Molecular Weight261.26 g/mol
Exact Mass261.09
IUPAC Name4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid
SMILESCc1cc(C)nc(Nc2ccc(C(=O)O)c(F)c2)n1
InChIInChI=1S/C13H12FN3O2/c1-7-5-8(2)16-13(15-7)17-9-3-4-10(12(18)19)11(14)6-9/h3-6H,1-2H3,(H,18,19)(H,15,16,17)
InChIKeyQUKHNCMRCZHHAT-UHFFFAOYSA-N
XLogP2.67
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.26
LogP ≤ 52.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid?
The IUPAC name of 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid (CID 114002149) is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid.
What is the SMILES notation for 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid?
The canonical SMILES for 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid is Cc1cc(C)nc(Nc2ccc(C(=O)O)c(F)c2)n1.
What is the InChIKey of 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid?
The InChIKey is QUKHNCMRCZHHAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN3O2/c1-7-5-8(2)16-13(15-7)17-9-3-4-10(12(18)19)11(14)6-9/h3-6H,1-2H3,(H,18,19)(H,15,16,17).
What are the key properties of 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid?
4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid has a molecular weight of 261.26 g/mol, XLogP of 2.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,6-dimethylpyrimidin-2-yl)amino]-2-fluorobenzoic acid is sourced from PubChem (CID 114002149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).