About (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate
(6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate (PubChem CID 7927784) has the molecular formula C18H12BrNO4
and a molecular weight of 386.20 g/mol. Its IUPAC name is (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate.
Molecular Properties
| Compound Name | (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate |
| PubChem CID | 7927784 |
| Molecular Formula | C18H12BrNO4 |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc3cc(Br)ccc3c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12BrNO4/c1-11-3-2-4-16(17(11)20(22)23)18(21)24-15-8-6-12-9-14(19)7-5-13(12)10-15/h2-10H,1H3 |
| InChIKey | XQUYOWAYQMMONC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate?
The IUPAC name of (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate (CID 7927784) is (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate.
What is the SMILES notation for (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate?
The canonical SMILES for (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate is Cc1cccc(C(=O)Oc2ccc3cc(Br)ccc3c2)c1[N+](=O)[O-].
What is the InChIKey of (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate?
The InChIKey is XQUYOWAYQMMONC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrNO4/c1-11-3-2-4-16(17(11)20(22)23)18(21)24-15-8-6-12-9-14(19)7-5-13(12)10-15/h2-10H,1H3.
What are the key properties of (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate?
(6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate has a molecular weight of 386.20 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromonaphthalen-2-yl) 3-methyl-2-nitrobenzoate is sourced from PubChem (CID 7927784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).