C17H16BrNO6 — CID 8947394
(2-bromo-4,5-dimethoxyphenyl)methyl 3-methyl-2-nitrobenzoate (PubChem CID 8947394) has the molecular formula C17H16BrNO6 and a molecular weight of 410.22 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)methyl 3-methyl-2-nitrobenzoate.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)methyl 3-methyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 8947394 |
| Molecular Formula | C17H16BrNO6 |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)methyl 3-methyl-2-nitrobenzoate |
| SMILES | COc1cc(Br)c(COC(=O)c2cccc(C)c2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H16BrNO6/c1-10-5-4-6-12(16(10)19(21)22)17(20)25-9-11-7-14(23-2)15(24-3)8-13(11)18/h4-8H,9H2,1-3H3 |
| InChIKey | JUWKFVGOBLAELQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|