About (4-propanoylphenyl) 3-methyl-2-nitrobenzoate
(4-propanoylphenyl) 3-methyl-2-nitrobenzoate (PubChem CID 7928197) has the molecular formula C17H15NO5
and a molecular weight of 313.31 g/mol. Its IUPAC name is (4-propanoylphenyl) 3-methyl-2-nitrobenzoate.
Molecular Properties
| Compound Name | (4-propanoylphenyl) 3-methyl-2-nitrobenzoate |
| PubChem CID | 7928197 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (4-propanoylphenyl) 3-methyl-2-nitrobenzoate |
| SMILES | CCC(=O)c1ccc(OC(=O)c2cccc(C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15NO5/c1-3-15(19)12-7-9-13(10-8-12)23-17(20)14-6-4-5-11(2)16(14)18(21)22/h4-10H,3H2,1-2H3 |
| InChIKey | TXUKYTNGJHEYON-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-propanoylphenyl) 3-methyl-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propanoylphenyl) 3-methyl-2-nitrobenzoate?
The IUPAC name of (4-propanoylphenyl) 3-methyl-2-nitrobenzoate (CID 7928197) is (4-propanoylphenyl) 3-methyl-2-nitrobenzoate.
What is the SMILES notation for (4-propanoylphenyl) 3-methyl-2-nitrobenzoate?
The canonical SMILES for (4-propanoylphenyl) 3-methyl-2-nitrobenzoate is CCC(=O)c1ccc(OC(=O)c2cccc(C)c2[N+](=O)[O-])cc1.
What is the InChIKey of (4-propanoylphenyl) 3-methyl-2-nitrobenzoate?
The InChIKey is TXUKYTNGJHEYON-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO5/c1-3-15(19)12-7-9-13(10-8-12)23-17(20)14-6-4-5-11(2)16(14)18(21)22/h4-10H,3H2,1-2H3.
What are the key properties of (4-propanoylphenyl) 3-methyl-2-nitrobenzoate?
(4-propanoylphenyl) 3-methyl-2-nitrobenzoate has a molecular weight of 313.31 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propanoylphenyl) 3-methyl-2-nitrobenzoate is sourced from PubChem (CID 7928197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).