C19H16BrN7O2 — CID 85032938
5-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-6-N-(3-methylphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 85032938) has the molecular formula C19H16BrN7O2 and a molecular weight of 454.29 g/mol. Its IUPAC name is 5-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-6-N-(3-methylphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 5-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-6-N-(3-methylphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 85032938 |
| Molecular Formula | C19H16BrN7O2 |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 5-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-6-N-(3-methylphenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | COc1ccc(Br)cc1C=NNc1nc2nonc2nc1Nc1cccc(C)c1 |
| InChI | InChI=1S/C19H16BrN7O2/c1-11-4-3-5-14(8-11)22-16-17(24-19-18(23-16)26-29-27-19)25-21-10-12-9-13(20)6-7-15(12)28-2/h3-10H,1-2H3,(H,22,23,26)(H,24,25,27) |
| InChIKey | POGOGVQAXZSGBZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|