C29H31N7O3 — CID 139976159
4-[[[2-[2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]-2,6-dimethylphenol (PubChem CID 139976159) has the molecular formula C29H31N7O3 and a molecular weight of 525.61 g/mol. Its IUPAC name is 4-[[[2-[2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]-2,6-dimethylphenol.
| Compound Name | 4-[[[2-[2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 139976159 |
| Molecular Formula | C29H31N7O3 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 4-[[[2-[2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]-2,6-dimethylphenol |
| SMILES | COc1ccccc1Nc1cc(NN=Cc2cc(C)c(O)c(C)c2)nc(NN=Cc2cc(C)c(O)c(C)c2)n1 |
| InChI | InChI=1S/C29H31N7O3/c1-17-10-21(11-18(2)27(17)37)15-30-35-26-14-25(32-23-8-6-7-9-24(23)39-5)33-29(34-26)36-31-16-22-12-19(3)28(38)20(4)13-22/h6-16,37-38H,1-5H3,(H3,32,33,34,35,36) |
| InChIKey | JNILHLNWFNJDQZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|