C26H25N7O2 — CID 139976229
2-N,4-N-bis[(4-methoxyphenyl)methylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 139976229) has the molecular formula C26H25N7O2 and a molecular weight of 467.53 g/mol. Its IUPAC name is 2-N,4-N-bis[(4-methoxyphenyl)methylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis[(4-methoxyphenyl)methylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976229 |
| Molecular Formula | C26H25N7O2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 2-N,4-N-bis[(4-methoxyphenyl)methylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | COc1ccc(C=NNc2cc(Nc3ccccc3)nc(NN=Cc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C26H25N7O2/c1-34-22-12-8-19(9-13-22)17-27-32-25-16-24(29-21-6-4-3-5-7-21)30-26(31-25)33-28-18-20-10-14-23(35-2)15-11-20/h3-18H,1-2H3,(H3,29,30,31,32,33) |
| InChIKey | MQHJKWVWJDRWLO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|