C30H29N7O2 — CID 139976385
2-N,4-N-bis[(5-methoxy-2,3-dihydroinden-1-ylidene)amino]-6-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 139976385) has the molecular formula C30H29N7O2 and a molecular weight of 519.61 g/mol. Its IUPAC name is 2-N,4-N-bis[(5-methoxy-2,3-dihydroinden-1-ylidene)amino]-6-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis[(5-methoxy-2,3-dihydroinden-1-ylidene)amino]-6-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976385 |
| Molecular Formula | C30H29N7O2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 2-N,4-N-bis[(5-methoxy-2,3-dihydroinden-1-ylidene)amino]-6-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | COc1ccc2c(c1)CCC2=NNc1cc(Nc2ccccc2)nc(NN=C2CCc3cc(OC)ccc32)n1 |
| InChI | InChI=1S/C30H29N7O2/c1-38-22-10-12-24-19(16-22)8-14-26(24)34-36-29-18-28(31-21-6-4-3-5-7-21)32-30(33-29)37-35-27-15-9-20-17-23(39-2)11-13-25(20)27/h3-7,10-13,16-18H,8-9,14-15H2,1-2H3,(H3,31,32,33,36,37) |
| InChIKey | VSDHCQZOYNRLEB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|