C28H23F2N7 — CID 139976216
2-N,4-N-bis[(5-fluoro-2,3-dihydroinden-1-ylidene)amino]-6-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 139976216) has the molecular formula C28H23F2N7 and a molecular weight of 495.54 g/mol. Its IUPAC name is 2-N,4-N-bis[(5-fluoro-2,3-dihydroinden-1-ylidene)amino]-6-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis[(5-fluoro-2,3-dihydroinden-1-ylidene)amino]-6-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976216 |
| Molecular Formula | C28H23F2N7 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 2-N,4-N-bis[(5-fluoro-2,3-dihydroinden-1-ylidene)amino]-6-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | Fc1ccc2c(c1)CCC2=NNc1cc(Nc2ccccc2)nc(NN=C2CCc3cc(F)ccc32)n1 |
| InChI | InChI=1S/C28H23F2N7/c29-19-8-10-22-17(14-19)6-12-24(22)34-36-27-16-26(31-21-4-2-1-3-5-21)32-28(33-27)37-35-25-13-7-18-15-20(30)9-11-23(18)25/h1-5,8-11,14-16H,6-7,12-13H2,(H3,31,32,33,36,37) |
| InChIKey | SVLPKDVEGITEPX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|