C32H33N7O2 — CID 139976197
4-N,6-N-bis[(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 139976197) has the molecular formula C32H33N7O2 and a molecular weight of 547.66 g/mol. Its IUPAC name is 4-N,6-N-bis[(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis[(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976197 |
| Molecular Formula | C32H33N7O2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 4-N,6-N-bis[(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | COc1ccc2c(c1)C(=NNc1cc(NN=C3CCCc4ccc(OC)cc43)nc(Nc3ccccc3)n1)CCC2 |
| InChI | InChI=1S/C32H33N7O2/c1-40-24-16-14-21-8-6-12-28(26(21)18-24)36-38-30-20-31(35-32(34-30)33-23-10-4-3-5-11-23)39-37-29-13-7-9-22-15-17-25(41-2)19-27(22)29/h3-5,10-11,14-20H,6-9,12-13H2,1-2H3,(H3,33,34,35,38,39) |
| InChIKey | KCARPKNCTRUVIO-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|