C31H31N7O — CID 139976561
2-N-(2-methoxyphenyl)-4-N,6-N-bis[(6-methyl-2,3-dihydroinden-1-ylidene)amino]pyrimidine-2,4,6-triamine (PubChem CID 139976561) has the molecular formula C31H31N7O and a molecular weight of 517.64 g/mol. Its IUPAC name is 2-N-(2-methoxyphenyl)-4-N,6-N-bis[(6-methyl-2,3-dihydroinden-1-ylidene)amino]pyrimidine-2,4,6-triamine.
| Compound Name | 2-N-(2-methoxyphenyl)-4-N,6-N-bis[(6-methyl-2,3-dihydroinden-1-ylidene)amino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976561 |
| Molecular Formula | C31H31N7O |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 2-N-(2-methoxyphenyl)-4-N,6-N-bis[(6-methyl-2,3-dihydroinden-1-ylidene)amino]pyrimidine-2,4,6-triamine |
| SMILES | COc1ccccc1Nc1nc(NN=C2CCc3ccc(C)cc32)cc(NN=C2CCc3ccc(C)cc32)n1 |
| InChI | InChI=1S/C31H31N7O/c1-19-8-10-21-12-14-25(23(21)16-19)35-37-29-18-30(34-31(33-29)32-27-6-4-5-7-28(27)39-3)38-36-26-15-13-22-11-9-20(2)17-24(22)26/h4-11,16-18H,12-15H2,1-3H3,(H3,32,33,34,37,38) |
| InChIKey | CEYFGEGFLYSVOK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|