C32H37N7O2 — CID 139976285
2-[[[6-anilino-2-[2-[(5-tert-butyl-2-hydroxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]-4-tert-butylphenol (PubChem CID 139976285) has the molecular formula C32H37N7O2 and a molecular weight of 551.70 g/mol. Its IUPAC name is 2-[[[6-anilino-2-[2-[(5-tert-butyl-2-hydroxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]-4-tert-butylphenol.
| Compound Name | 2-[[[6-anilino-2-[2-[(5-tert-butyl-2-hydroxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]-4-tert-butylphenol |
|---|---|
| PubChem CID | 139976285 |
| Molecular Formula | C32H37N7O2 |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | 2-[[[6-anilino-2-[2-[(5-tert-butyl-2-hydroxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]-4-tert-butylphenol |
| SMILES | CC(C)(C)c1ccc(O)c(C=NNc2cc(Nc3ccccc3)nc(NN=Cc3cc(C(C)(C)C)ccc3O)n2)c1 |
| InChI | InChI=1S/C32H37N7O2/c1-31(2,3)23-12-14-26(40)21(16-23)19-33-38-29-18-28(35-25-10-8-7-9-11-25)36-30(37-29)39-34-20-22-17-24(32(4,5)6)13-15-27(22)41/h7-20,40-41H,1-6H3,(H3,35,36,37,38,39) |
| InChIKey | FGJNNSWSYNWQKA-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|