C24H17Cl2F2N7 — CID 139976959
2-N,4-N-bis[(2-chloro-6-fluorophenyl)methylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 139976959) has the molecular formula C24H17Cl2F2N7 and a molecular weight of 512.35 g/mol. Its IUPAC name is 2-N,4-N-bis[(2-chloro-6-fluorophenyl)methylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis[(2-chloro-6-fluorophenyl)methylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976959 |
| Molecular Formula | C24H17Cl2F2N7 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 2-N,4-N-bis[(2-chloro-6-fluorophenyl)methylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | Fc1cccc(Cl)c1C=NNc1cc(Nc2ccccc2)nc(NN=Cc2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C24H17Cl2F2N7/c25-18-8-4-10-20(27)16(18)13-29-34-23-12-22(31-15-6-2-1-3-7-15)32-24(33-23)35-30-14-17-19(26)9-5-11-21(17)28/h1-14H,(H3,31,32,33,34,35) |
| InChIKey | MTXQOEAMLMQQLY-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|