C27H27N7O5 — CID 139976686
2-[[[2-[2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]-5-methoxyphenol (PubChem CID 139976686) has the molecular formula C27H27N7O5 and a molecular weight of 529.56 g/mol. Its IUPAC name is 2-[[[2-[2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]-5-methoxyphenol.
| Compound Name | 2-[[[2-[2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 139976686 |
| Molecular Formula | C27H27N7O5 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 2-[[[2-[2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-6-(2-methoxyanilino)pyrimidin-4-yl]hydrazinylidene]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(C=NNc2cc(Nc3ccccc3OC)nc(NN=Cc3ccc(OC)cc3O)n2)c(O)c1 |
| InChI | InChI=1S/C27H27N7O5/c1-37-19-10-8-17(22(35)12-19)15-28-33-26-14-25(30-21-6-4-5-7-24(21)39-3)31-27(32-26)34-29-16-18-9-11-20(38-2)13-23(18)36/h4-16,35-36H,1-3H3,(H3,30,31,32,33,34) |
| InChIKey | NWEVWLTXBKUYDE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|