C16H14ClN5OS — CID 135795531
4-chloro-N-(2-methoxyphenyl)-5-[(E)-(pyridin-2-ylhydrazinylidene)methyl]-1,3-thiazol-2-amine (PubChem CID 135795531) has the molecular formula C16H14ClN5OS and a molecular weight of 359.84 g/mol. Its IUPAC name is 4-chloro-N-(2-methoxyphenyl)-5-[(E)-(pyridin-2-ylhydrazinylidene)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-(2-methoxyphenyl)-5-[(E)-(pyridin-2-ylhydrazinylidene)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135795531 |
| Molecular Formula | C16H14ClN5OS |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 4-chloro-N-(2-methoxyphenyl)-5-[(E)-(pyridin-2-ylhydrazinylidene)methyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccccc1Nc1nc(Cl)c(/C=N/Nc2ccccn2)s1 |
| InChI | InChI=1S/C16H14ClN5OS/c1-23-12-7-3-2-6-11(12)20-16-21-15(17)13(24-16)10-19-22-14-8-4-5-9-18-14/h2-10H,1H3,(H,18,22)(H,20,21)/b19-10+ |
| InChIKey | QFVFSDBGQFQKSQ-VXLYETTFSA-N |
| XLogP | 4.39 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|