C16H14Br2ClN3O3 — CID 4218746
2,4-dibromo-6-[3-(2-chloro-4-nitroanilino)propyliminomethyl]phenol (PubChem CID 4218746) has the molecular formula C16H14Br2ClN3O3 and a molecular weight of 491.57 g/mol. Its IUPAC name is 2,4-dibromo-6-[3-(2-chloro-4-nitroanilino)propyliminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[3-(2-chloro-4-nitroanilino)propyliminomethyl]phenol |
|---|---|
| PubChem CID | 4218746 |
| Molecular Formula | C16H14Br2ClN3O3 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 488.91 |
| IUPAC Name | 2,4-dibromo-6-[3-(2-chloro-4-nitroanilino)propyliminomethyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(NCCC/N=C/c2cc(Br)cc(Br)c2O)c(Cl)c1 |
| InChI | InChI=1S/C16H14Br2ClN3O3/c17-11-6-10(16(23)13(18)7-11)9-20-4-1-5-21-15-3-2-12(22(24)25)8-14(15)19/h2-3,6-9,21,23H,1,4-5H2/b20-9+ |
| InChIKey | HJMBETHRYACLNW-AWQFTUOYSA-N |
| XLogP | 5.40 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|