C23H20Cl3N3O3 — CID 4301729
2-chloro-6-[3-(2-chloro-4-nitroanilino)propyliminomethyl]-4-[(2-chlorophenyl)methyl]phenol (PubChem CID 4301729) has the molecular formula C23H20Cl3N3O3 and a molecular weight of 492.79 g/mol. Its IUPAC name is 2-chloro-6-[3-(2-chloro-4-nitroanilino)propyliminomethyl]-4-[(2-chlorophenyl)methyl]phenol.
| Compound Name | 2-chloro-6-[3-(2-chloro-4-nitroanilino)propyliminomethyl]-4-[(2-chlorophenyl)methyl]phenol |
|---|---|
| PubChem CID | 4301729 |
| Molecular Formula | C23H20Cl3N3O3 |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 2-chloro-6-[3-(2-chloro-4-nitroanilino)propyliminomethyl]-4-[(2-chlorophenyl)methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(NCCC/N=C/c2cc(Cc3ccccc3Cl)cc(Cl)c2O)c(Cl)c1 |
| InChI | InChI=1S/C23H20Cl3N3O3/c24-19-5-2-1-4-16(19)10-15-11-17(23(30)21(26)12-15)14-27-8-3-9-28-22-7-6-18(29(31)32)13-20(22)25/h1-2,4-7,11-14,28,30H,3,8-10H2/b27-14+ |
| InChIKey | JEJJQTLNMHOBFP-MZJWZYIUSA-N |
| XLogP | 6.77 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|