C10H11N5O3 — CID 177469296
4-[(E)-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)methyl]-2-nitrophenol (PubChem CID 177469296) has the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. Its IUPAC name is 4-[(E)-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)methyl]-2-nitrophenol.
| Compound Name | 4-[(E)-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)methyl]-2-nitrophenol |
|---|---|
| PubChem CID | 177469296 |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-[(E)-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)methyl]-2-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(/C=N/NC2=NCCN2)ccc1O |
| InChI | InChI=1S/C10H11N5O3/c16-9-2-1-7(5-8(9)15(17)18)6-13-14-10-11-3-4-12-10/h1-2,5-6,16H,3-4H2,(H2,11,12,14)/b13-6+ |
| InChIKey | JVNFCYCYVURJJX-AWNIVKPZSA-N |
| XLogP | 0.18 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|