C10H8N6O4 — CID 136732944
5-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one (PubChem CID 136732944) has the molecular formula C10H8N6O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is 5-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 136732944 |
| Molecular Formula | C10H8N6O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 5-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one |
| SMILES | O=c1nc(N/N=C/c2ccc(O)c([N+](=O)[O-])c2)cn[nH]1 |
| InChI | InChI=1S/C10H8N6O4/c17-8-2-1-6(3-7(8)16(19)20)4-11-14-9-5-12-15-10(18)13-9/h1-5,17H,(H2,13,14,15,18)/b11-4+ |
| InChIKey | IZURFTBKOAYXIX-NYYWCZLTSA-N |
| XLogP | 0.22 |
| TPSA | 146.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|