C18H12N4O5S — CID 170918842
(Z)-2-cyano-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170918842) has the molecular formula C18H12N4O5S and a molecular weight of 396.38 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170918842 |
| Molecular Formula | C18H12N4O5S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | (Z)-2-cyano-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc(-c2ccc(/C=C(/C#N)C(=O)Nc3nccs3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12N4O5S/c1-26-12-2-4-14(15(9-12)22(24)25)16-5-3-13(27-16)8-11(10-19)17(23)21-18-20-6-7-28-18/h2-9H,1H3,(H,20,21,23)/b11-8- |
| InChIKey | KKYUTRROEAVJKY-FLIBITNWSA-N |
| XLogP | 3.87 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|