C20H29N3O3S — CID 144928134
(E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-[4-(dipropylamino)phenyl]prop-2-enenitrile (PubChem CID 144928134) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is (E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-[4-(dipropylamino)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-[4-(dipropylamino)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 144928134 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-[4-(dipropylamino)phenyl]prop-2-enenitrile |
| SMILES | CCCN(CCC)c1ccc(/C=C(\C#N)SNC2CC(O)COC2O)cc1 |
| InChI | InChI=1S/C20H29N3O3S/c1-3-9-23(10-4-2)16-7-5-15(6-8-16)11-18(13-21)27-22-19-12-17(24)14-26-20(19)25/h5-8,11,17,19-20,22,24-25H,3-4,9-10,12,14H2,1-2H3/b18-11+ |
| InChIKey | ZMFZPESUVAWTIC-WOJGMQOQSA-N |
| XLogP | 2.88 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|