C26H45N3O — CID 144927850
(2Z)-3-amino-2-[[4-(dipropylamino)phenyl]methylidene]butanenitrile;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane (PubChem CID 144927850) has the molecular formula C26H45N3O and a molecular weight of 415.67 g/mol. Its IUPAC name is (2Z)-3-amino-2-[[4-(dipropylamino)phenyl]methylidene]butanenitrile;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane.
| Compound Name | (2Z)-3-amino-2-[[4-(dipropylamino)phenyl]methylidene]butanenitrile;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane |
|---|---|
| PubChem CID | 144927850 |
| Molecular Formula | C26H45N3O |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.36 |
| IUPAC Name | (2Z)-3-amino-2-[[4-(dipropylamino)phenyl]methylidene]butanenitrile;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane |
| SMILES | CC(C)CCOC(C)(C)C.CCCN(CCC)c1ccc(/C=C(\C#N)C(C)N)cc1 |
| InChI | InChI=1S/C17H25N3.C9H20O/c1-4-10-20(11-5-2)17-8-6-15(7-9-17)12-16(13-18)14(3)19;1-8(2)6-7-10-9(3,4)5/h6-9,12,14H,4-5,10-11,19H2,1-3H3;8H,6-7H2,1-5H3/b16-12+; |
| InChIKey | FONIOXRXAKBJDC-CLNHMMGSSA-N |
| XLogP | 6.41 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|