C19H29N3O2 — CID 153371349
(E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enamide;3-methylbutan-1-ol (PubChem CID 153371349) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enamide;3-methylbutan-1-ol.
| Compound Name | (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enamide;3-methylbutan-1-ol |
|---|---|
| PubChem CID | 153371349 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enamide;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.CCN(CC)c1ccc(/C=C(\C#N)C(N)=O)cc1 |
| InChI | InChI=1S/C14H17N3O.C5H12O/c1-3-17(4-2)13-7-5-11(6-8-13)9-12(10-15)14(16)18;1-5(2)3-4-6/h5-9H,3-4H2,1-2H3,(H2,16,18);5-6H,3-4H2,1-2H3/b12-9+; |
| InChIKey | IXECQNOXSWYUML-NBYYMMLRSA-N |
| XLogP | 2.95 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|