C18H23N3O2 — CID 4244992
3-[4-(diethylamino)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile (PubChem CID 4244992) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[4-(diethylamino)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[4-(diethylamino)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4244992 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-[4-(diethylamino)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile |
| SMILES | CCN(CC)c1ccc(C=C(C#N)C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H23N3O2/c1-3-20(4-2)17-7-5-15(6-8-17)13-16(14-19)18(22)21-9-11-23-12-10-21/h5-8,13H,3-4,9-12H2,1-2H3 |
| InChIKey | UMHYYALFRRRPSW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|