C23H41N3OS — CID 144927988
(E)-2-aminosulfanyl-3-[4-(diethylamino)phenyl]but-2-enenitrile;3-methylbutan-1-ol;2-methylpropane (PubChem CID 144927988) has the molecular formula C23H41N3OS and a molecular weight of 407.67 g/mol. Its IUPAC name is (E)-2-aminosulfanyl-3-[4-(diethylamino)phenyl]but-2-enenitrile;3-methylbutan-1-ol;2-methylpropane.
| Compound Name | (E)-2-aminosulfanyl-3-[4-(diethylamino)phenyl]but-2-enenitrile;3-methylbutan-1-ol;2-methylpropane |
|---|---|
| PubChem CID | 144927988 |
| Molecular Formula | C23H41N3OS |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | (E)-2-aminosulfanyl-3-[4-(diethylamino)phenyl]but-2-enenitrile;3-methylbutan-1-ol;2-methylpropane |
| SMILES | CC(C)C.CC(C)CCO.CCN(CC)c1ccc(/C(C)=C(\C#N)SN)cc1 |
| InChI | InChI=1S/C14H19N3S.C5H12O.C4H10/c1-4-17(5-2)13-8-6-12(7-9-13)11(3)14(10-15)18-16;1-5(2)3-4-6;1-4(2)3/h6-9H,4-5,16H2,1-3H3;5-6H,3-4H2,1-2H3;4H,1-3H3/b14-11+;; |
| InChIKey | SJGCJLPRFMWURB-IVKCLRODSA-N |
| XLogP | 6.08 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|