C20H29N3O5 — CID 166868620
(E)-2-cyano-3-[4-(diethylamino)phenyl]-N-[(2R,3R,4R,5S)-2,3,4,5-tetrahydroxyhexyl]prop-2-enamide (PubChem CID 166868620) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(diethylamino)phenyl]-N-[(2R,3R,4R,5S)-2,3,4,5-tetrahydroxyhexyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(diethylamino)phenyl]-N-[(2R,3R,4R,5S)-2,3,4,5-tetrahydroxyhexyl]prop-2-enamide |
|---|---|
| PubChem CID | 166868620 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (E)-2-cyano-3-[4-(diethylamino)phenyl]-N-[(2R,3R,4R,5S)-2,3,4,5-tetrahydroxyhexyl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(/C=C(\C#N)C(=O)NC[C@@H](O)[C@@H](O)[C@H](O)[C@H](C)O)cc1 |
| InChI | InChI=1S/C20H29N3O5/c1-4-23(5-2)16-8-6-14(7-9-16)10-15(11-21)20(28)22-12-17(25)19(27)18(26)13(3)24/h6-10,13,17-19,24-27H,4-5,12H2,1-3H3,(H,22,28)/b15-10+/t13-,17+,18+,19+/m0/s1 |
| InChIKey | FZGIOJWTHWENEB-KGADQSCBSA-N |
| XLogP | 0.02 |
| TPSA | 137.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|