C24H26N2S2 — CID 153371579
(E)-3-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-2-methylsulfanylprop-2-enenitrile (PubChem CID 153371579) has the molecular formula C24H26N2S2 and a molecular weight of 406.62 g/mol. Its IUPAC name is (E)-3-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-2-methylsulfanylprop-2-enenitrile.
| Compound Name | (E)-3-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-2-methylsulfanylprop-2-enenitrile |
|---|---|
| PubChem CID | 153371579 |
| Molecular Formula | C24H26N2S2 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (E)-3-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-2-methylsulfanylprop-2-enenitrile |
| SMILES | CCCN(CCC)c1ccc2cc(-c3ccc(/C=C(\C#N)SC)s3)ccc2c1 |
| InChI | InChI=1S/C24H26N2S2/c1-4-12-26(13-5-2)21-9-8-18-14-20(7-6-19(18)15-21)24-11-10-22(28-24)16-23(17-25)27-3/h6-11,14-16H,4-5,12-13H2,1-3H3/b23-16+ |
| InChIKey | GAZIVSBHQDLTQV-XQNSMLJCSA-N |
| XLogP | 7.42 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|