C32H43N3O2S — CID 144928215
(E)-3-[5-[6-(dipropylamino)naphthalen-2-yl]furan-2-yl]-2-[[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]amino]sulfanylprop-2-enenitrile (PubChem CID 144928215) has the molecular formula C32H43N3O2S and a molecular weight of 533.78 g/mol. Its IUPAC name is (E)-3-[5-[6-(dipropylamino)naphthalen-2-yl]furan-2-yl]-2-[[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]amino]sulfanylprop-2-enenitrile.
| Compound Name | (E)-3-[5-[6-(dipropylamino)naphthalen-2-yl]furan-2-yl]-2-[[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]amino]sulfanylprop-2-enenitrile |
|---|---|
| PubChem CID | 144928215 |
| Molecular Formula | C32H43N3O2S |
| Molecular Weight | 533.78 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | (E)-3-[5-[6-(dipropylamino)naphthalen-2-yl]furan-2-yl]-2-[[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]amino]sulfanylprop-2-enenitrile |
| SMILES | CCCN(CCC)c1ccc2cc(-c3ccc(/C=C(\C#N)SNC(C)(C)CCOC(C)(C)C)o3)ccc2c1 |
| InChI | InChI=1S/C32H43N3O2S/c1-8-17-35(18-9-2)27-13-12-24-20-26(11-10-25(24)21-27)30-15-14-28(37-30)22-29(23-33)38-34-32(6,7)16-19-36-31(3,4)5/h10-15,20-22,34H,8-9,16-19H2,1-7H3/b29-22+ |
| InChIKey | RECJDEHZQMAERG-QUPMIFSKSA-N |
| XLogP | 8.81 |
| TPSA | 61.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.78 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|