C30H36N4O8S — CID 122683018
(E)-1-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]furan-2-yl]ethenesulfonamide (PubChem CID 122683018) has the molecular formula C30H36N4O8S and a molecular weight of 612.71 g/mol. Its IUPAC name is (E)-1-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]furan-2-yl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]furan-2-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 122683018 |
| Molecular Formula | C30H36N4O8S |
| Molecular Weight | 612.71 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | (E)-1-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]furan-2-yl]ethenesulfonamide |
| SMILES | CC[C@H]1OC(O)[C@H](NS(=O)(=O)/C(C#N)=C/c2ccc(-c3ccc4cc(NCCN5CCOCC5)ccc4c3)o2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H36N4O8S/c1-2-25-28(35)29(36)27(30(37)42-25)33-43(38,39)24(18-31)17-23-7-8-26(41-23)21-4-3-20-16-22(6-5-19(20)15-21)32-9-10-34-11-13-40-14-12-34/h3-8,15-17,25,27-30,32-33,35-37H,2,9-14H2,1H3/b24-17+/t25-,27-,28-,29-,30?/m1/s1 |
| InChIKey | PGJHFHSRGDGBDY-BTPVFKLWSA-N |
| XLogP | 1.85 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.71 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|