C12H23N3O4 — CID 108517619
N'-(1-hydroxy-2-methylpropan-2-yl)-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 108517619) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is N'-(1-hydroxy-2-methylpropan-2-yl)-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-(1-hydroxy-2-methylpropan-2-yl)-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108517619 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N'-(1-hydroxy-2-methylpropan-2-yl)-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | CC(C)(CO)NC(=O)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C12H23N3O4/c1-12(2,9-16)14-11(18)10(17)13-3-4-15-5-7-19-8-6-15/h16H,3-9H2,1-2H3,(H,13,17)(H,14,18) |
| InChIKey | RGCHXOHBNPBUSX-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|