C27H32N4O3S2 — CID 145041328
(E)-2-(2,3-dihydroxypropylamino)sulfanyl-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]but-2-enenitrile (PubChem CID 145041328) has the molecular formula C27H32N4O3S2 and a molecular weight of 524.71 g/mol. Its IUPAC name is (E)-2-(2,3-dihydroxypropylamino)sulfanyl-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]but-2-enenitrile.
| Compound Name | (E)-2-(2,3-dihydroxypropylamino)sulfanyl-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 145041328 |
| Molecular Formula | C27H32N4O3S2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (E)-2-(2,3-dihydroxypropylamino)sulfanyl-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]but-2-enenitrile |
| SMILES | C/C(=C(/C#N)SNCC(O)CO)c1ccc(-c2ccc3cc(NCCN4CCOCC4)ccc3c2)s1 |
| InChI | InChI=1S/C27H32N4O3S2/c1-19(27(16-28)36-30-17-24(33)18-32)25-6-7-26(35-25)22-3-2-21-15-23(5-4-20(21)14-22)29-8-9-31-10-12-34-13-11-31/h2-7,14-15,24,29-30,32-33H,8-13,17-18H2,1H3/b27-19+ |
| InChIKey | AHGMNQKFSHWJIA-ZXVVBBHZSA-N |
| XLogP | 4.16 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|